Products 856301-51-4
CAS 856301-51-4 is the registry number for 2-(4-Chlorophenyl)-2H-benzo[e][1,2,4]thiadiazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)-4H-1,2,4-benzothiadiazin-3-one (CAS 856301-51-4) is a chemical compound with the molecular formula C13H9ClN2OS and a molecular weight of 276.74 g/mol. IUPAC name: 2-(4-chlorophenyl)-4H-1,2,4-benzothiadiazin-3-one. InChIKey: DYGRGNCTZCLJEV-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2OS |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4H-1,2,4-benzothiadiazin-3-one |
| InChIKey | DYGRGNCTZCLJEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)N(S2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)