CAS 85811-56-9 appears in our catalog under these names: 7-(Chloromethyl)-3-phenyl-5h-[1,3]thiazolo[3,2-a]pyrimidin-5-one, 95%, 7-(Chloromethyl)-3-phenyl-5H-thiazolo(3,2-a)pyrimidin-5-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
7-(chloromethyl)-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CAS 85811-56-9) is a chemical compound with the molecular formula C13H9ClN2OS and a molecular weight of 276.74 g/mol. IUPAC name: 7-(chloromethyl)-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one. InChIKey: HWABSWUKDMJGDF-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2OS |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 7-(chloromethyl)-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | HWABSWUKDMJGDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=NC(=CC(=O)N23)CCl |
Computed by PubChem (NCBI)