CAS 677713-46-1 is the registry number for 4-(2-Chlorophenyl)-6-methylthieno(2,3-d)pyrimidin-2(1H)-one. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
4-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-2-one (CAS 677713-46-1) is a chemical compound with the molecular formula C13H9ClN2OS and a molecular weight of 276.74 g/mol. IUPAC name: 4-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-2-one. InChIKey: LJEVGRNHKFUVQM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2OS |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-2-one |
| InChIKey | LJEVGRNHKFUVQM-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(NC(=O)N=C2S1)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)