CAS 852218-16-7 is the registry number for 2-(Chloromethyl)-6-phenylthieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 10g.
2-(chloromethyl)-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 852218-16-7) is a chemical compound with the molecular formula C13H9ClN2OS and a molecular weight of 276.74 g/mol. IUPAC name: 2-(chloromethyl)-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: XIZLGTMVTXLUGC-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2OS |
|---|---|
| Molecular weight | 276.74 g/mol |
| IUPAC name | 2-(chloromethyl)-6-phenyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | XIZLGTMVTXLUGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)N=C(NC3=O)CCl |
Computed by PubChem (NCBI)