Products 312615-59-1
CAS 312615-59-1 is the registry number for N-(2-Oxo-6-(trifluoromethyl)-2H-pyran-3-yl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[2-oxo-6-(trifluoromethyl)pyran-3-yl]benzamide (CAS 312615-59-1) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: N-[2-oxo-6-(trifluoromethyl)pyran-3-yl]benzamide. InChIKey: DIMPADHKHYVVBD-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | N-[2-oxo-6-(trifluoromethyl)pyran-3-yl]benzamide |
| InChIKey | DIMPADHKHYVVBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(OC2=O)C(F)(F)F |
Computed by PubChem (NCBI)