Products 31301-28-7
CAS 31301-28-7 appears in our catalog under these names: 4-Methyl-1,10-phenanthroline, 95%, 4–Methyl–1,10–phenanthroline, 4-Methyl-1,10-phenanthroline , 4-Methyl-1,10-phenanthroline, 4-Methyl-1,10-phenanthroline 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
4-methyl-1,10-phenanthroline (CAS 31301-28-7) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 4-methyl-1,10-phenanthroline. InChIKey: NAZZKEZTSOOCSZ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 4-methyl-1,10-phenanthroline |
| InChIKey | NAZZKEZTSOOCSZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=NC=C1)N=CC=C3 |
Computed by PubChem (NCBI)