Products 313339-91-2
CAS 313339-91-2 is the registry number for Ethyl 3,5-dichloropyrazine-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 3,5-dichloropyrazine-2-carboxylate (CAS 313339-91-2) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: ethyl 3,5-dichloropyrazine-2-carboxylate. InChIKey: WDQSZLFJRHJQGN-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | ethyl 3,5-dichloropyrazine-2-carboxylate |
| InChIKey | WDQSZLFJRHJQGN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(N=C1Cl)Cl |
Computed by PubChem (NCBI)