Products 313346-41-7
CAS 313346-41-7 appears in our catalog under these names: 5-[(Cyclohexylamino)sulfonyl]-2-methylbenzoic acid, 95%, 5-(Cyclohexylsulfamoyl)-2-methylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(cyclohexylsulfamoyl)-2-methylbenzoic acid (CAS 313346-41-7) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 5-(cyclohexylsulfamoyl)-2-methylbenzoic acid. InChIKey: QUEHYZPROBRWIP-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 5-(cyclohexylsulfamoyl)-2-methylbenzoic acid |
| InChIKey | QUEHYZPROBRWIP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC2CCCCC2)C(=O)O |
Computed by PubChem (NCBI)