Products 727983-31-5

CAS 727983-31-5 is the registry number for 1-[(3,4-Dimethylphenyl)sulfonyl]piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 727983-31-5) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: DUVSLYPVXCOUTN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO4S
Molecular weight297.37 g/mol
IUPAC name1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid
InChIKeyDUVSLYPVXCOUTN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)S(=O)(=O)N2CCC(CC2)C(=O)O)C

Computed by PubChem (NCBI)