CAS 727983-31-5 is the registry number for 1-[(3,4-Dimethylphenyl)sulfonyl]piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 727983-31-5) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: DUVSLYPVXCOUTN-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | DUVSLYPVXCOUTN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)N2CCC(CC2)C(=O)O)C |
Computed by PubChem (NCBI)