CAS 870693-16-6 is the registry number for 4-(5,6,7,8-Tetrahydronaphthalene-2-sulfonamido)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanoic acid (CAS 870693-16-6) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanoic acid. InChIKey: FVUIMCXWRUBWBI-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)butanoic acid |
| InChIKey | FVUIMCXWRUBWBI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)