CAS 163705-28-0 appears in our catalog under these names: Boc-(s)-phenyl-l-cys, 95%, Boc-L-Cys(Ph)-OH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid (CAS 163705-28-0) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid. InChIKey: IBEVTCWKECBMJF-NSHDSACASA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylsulfanylpropanoic acid |
| InChIKey | IBEVTCWKECBMJF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)