CAS 757192-81-7 appears in our catalog under these names: 1-[(2,4-Dimethylphenyl)sulfonyl]piperidine-4-carboxylic acid, 95%, 1-(2,4-Dimethylbenzenesulfonyl)piperidine-4-carboxylic acid, 95%, 1-(2,4-Dimethylbenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 757192-81-7) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: HXHCPNPCXHOMLI-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | HXHCPNPCXHOMLI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)N2CCC(CC2)C(=O)O)C |
Computed by PubChem (NCBI)