Products 1820575-20-9
CAS 1820575-20-9 appears in our catalog under these names: Boc-(+/-)-trans-4-(3-thienyl)-pyrrolidine-3-carboxylic acid, 95%, Boc-(+/-)-trans-4-(3-thienyl)-pyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
(3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-thiophen-3-ylpyrrolidine-3-carboxylic acid (CAS 1820575-20-9) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-thiophen-3-ylpyrrolidine-3-carboxylic acid. InChIKey: SMFRPIXMKBJZBM-MNOVXSKESA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | (3R,4S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-thiophen-3-ylpyrrolidine-3-carboxylic acid |
| InChIKey | SMFRPIXMKBJZBM-MNOVXSKESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CSC=C2 |
Computed by PubChem (NCBI)