Products 315228-19-4
CAS 315228-19-4 appears in our catalog under these names: 2–Fluoro–4–nitrophenylacetic Acid, 2-Fluoro-4-nitrophenylacetic acid, 2-(2-Fluoro-4-nitrophenyl)acetic acid 95%, 2-(2-Fluoro-4-nitrophenyl)acetic acid, 98%, 2-(2-Fluoro-4-nitrophenyl)acetic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100g, 500g.
2-(2-fluoro-4-nitrophenyl)acetic acid (CAS 315228-19-4) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(2-fluoro-4-nitrophenyl)acetic acid. InChIKey: HKGNZXXYXCKJHO-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(2-fluoro-4-nitrophenyl)acetic acid |
| InChIKey | HKGNZXXYXCKJHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)CC(=O)O |
Computed by PubChem (NCBI)