Products 31645-34-8
CAS 31645-34-8 appears in our catalog under these names: 9–Anthracenylmethyl acrylate, Anthracen-9-ylmethyl acrylate 98%, 9-ANTHRACENYLMETHYL ACRYLATE, 98%, Anthracen-9-Ylmethyl Acrylate, 98%, 98%, Anthracen-9-ylmethyl acrylate, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100mg, 10g.
Anthracen-9-ylmethyl prop-2-enoate (CAS 31645-34-8) is a chemical compound with the molecular formula C18H14O2 and a molecular weight of 262.3 g/mol. IUPAC name: anthracen-9-ylmethyl prop-2-enoate. InChIKey: IPLSGZRALKDNRS-UHFFFAOYSA-N.
| Molecular formula | C18H14O2 |
|---|---|
| Molecular weight | 262.3 g/mol |
| IUPAC name | anthracen-9-ylmethyl prop-2-enoate |
| InChIKey | IPLSGZRALKDNRS-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC1=C2C=CC=CC2=CC3=CC=CC=C31 |
Computed by PubChem (NCBI)