CAS 31645-94-0 is the registry number for 1-(3-Methyl-4h-1,4-benzothiazin-2-yl)ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethanone (CAS 31645-94-0) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethanone. InChIKey: WBZVLPUFAVZNKB-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 1-(3-methyl-4H-1,4-benzothiazin-2-yl)ethanone |
| InChIKey | WBZVLPUFAVZNKB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CC=CC=C2N1)C(=O)C |
Computed by PubChem (NCBI)