CAS 83414-17-9 is the registry number for 5'-(Methylsulfanyl)-1',2'-dihydrospiro[cyclopropane-1,3'-indole]-2'-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-methylsulfanylspiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 83414-17-9) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 5-methylsulfanylspiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: GRPDMIWWIAFWOD-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5-methylsulfanylspiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | GRPDMIWWIAFWOD-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=C(C=C1)NC(=O)C23CC3 |
Computed by PubChem (NCBI)