CAS 50834-78-1 is the registry number for 4-(4-Methoxyphenyl)-2-methylthiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(4-methoxyphenyl)-2-methyl-1,3-thiazole (CAS 50834-78-1) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 4-(4-methoxyphenyl)-2-methyl-1,3-thiazole. InChIKey: OVKCVKLSCKKRJY-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)-2-methyl-1,3-thiazole |
| InChIKey | OVKCVKLSCKKRJY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)