CAS 696602-83-2 is the registry number for 2-(4-Phenyl-1,3-thiazol-2-yl)ethanol, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
2-(4-phenyl-1,3-thiazol-2-yl)ethanol (CAS 696602-83-2) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 2-(4-phenyl-1,3-thiazol-2-yl)ethanol. InChIKey: QGFOTYNEYWHIAV-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 2-(4-phenyl-1,3-thiazol-2-yl)ethanol |
| InChIKey | QGFOTYNEYWHIAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CCO |
Computed by PubChem (NCBI)