CAS 857284-12-9 appears in our catalog under these names: (2-Methyl-4-phenyl-1,3-thiazol-5-yl)methanol, 95%, (2-Methyl-4-phenyl-1,3-thiazol-5-yl)methanol, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250MG.
(2-methyl-4-phenyl-1,3-thiazol-5-yl)methanol (CAS 857284-12-9) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: (2-methyl-4-phenyl-1,3-thiazol-5-yl)methanol. InChIKey: RBRYERMYEBFVAB-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | (2-methyl-4-phenyl-1,3-thiazol-5-yl)methanol |
| InChIKey | RBRYERMYEBFVAB-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)CO)C2=CC=CC=C2 |
Computed by PubChem (NCBI)