CAS 915882-17-6 is the registry number for (3-Aminophenyl)(2-thienyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.
(3-aminophenyl)-thiophen-2-ylmethanol (CAS 915882-17-6) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: (3-aminophenyl)-thiophen-2-ylmethanol. InChIKey: PCULMMADXLYFKA-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | (3-aminophenyl)-thiophen-2-ylmethanol |
| InChIKey | PCULMMADXLYFKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(C2=CC=CS2)O |
Computed by PubChem (NCBI)