Products 3167-06-4

CAS 3167-06-4 is the registry number for Dopamine Impurity 25 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,6-dimethoxyphenyl)ethanamine;hydrochloride (CAS 3167-06-4) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 2-(2,6-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: FZPYNVOENQIUDB-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16ClNO2
Molecular weight217.69 g/mol
IUPAC name2-(2,6-dimethoxyphenyl)ethanamine;hydrochloride
InChIKeyFZPYNVOENQIUDB-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)OC)CCN.Cl

Computed by PubChem (NCBI)