CAS 31676-43-4 is the registry number for N-Acetyl-2,3-dimethylindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-(2,3-dimethylindol-1-yl)ethanone (CAS 31676-43-4) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 1-(2,3-dimethylindol-1-yl)ethanone. InChIKey: UCHBCCUSCVVGCY-UHFFFAOYSA-N.
| Molecular formula | C12H13NO |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1-(2,3-dimethylindol-1-yl)ethanone |
| InChIKey | UCHBCCUSCVVGCY-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C2=CC=CC=C12)C(=O)C)C |
Computed by PubChem (NCBI)