CAS 31676-55-8 appears in our catalog under these names: 5-Phenylpyridin-3-ol, 97%, 5-Phenylpyridin-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-phenylpyridin-3-ol (CAS 31676-55-8) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 5-phenylpyridin-3-ol. InChIKey: NUTMKQSGPRZCAU-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 5-phenylpyridin-3-ol |
| InChIKey | NUTMKQSGPRZCAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)O |
Computed by PubChem (NCBI)