Products 31785-09-8
CAS 31785-09-8 is the registry number for N-(1,3-Diamino-1-oxo-3-thioxopropan-2-yl)benzamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl)benzamide (CAS 31785-09-8) is a chemical compound with the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. IUPAC name: N-(1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl)benzamide. InChIKey: DEPJTXJWQDNASL-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | N-(1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl)benzamide |
| InChIKey | DEPJTXJWQDNASL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(C(=O)N)C(=S)N |
Computed by PubChem (NCBI)