Products 32003-41-1
CAS 32003-41-1 is the registry number for 3-(2,3-Dichlorobenzoyl)-propionic Acid. Offered by: TRC. Available pack sizes: 100mg, 1g.
4-(2,3-dichlorophenyl)-4-oxobutanoic acid (CAS 32003-41-1) is a chemical compound with the molecular formula C10H8Cl2O3 and a molecular weight of 247.07 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)-4-oxobutanoic acid. InChIKey: ZDPLPJUODUTOIR-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O3 |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)-4-oxobutanoic acid |
| InChIKey | ZDPLPJUODUTOIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)