CAS 32099-65-3 appears in our catalog under these names: 1–(4–(Phenylamino)phenyl)–1H–pyrrole–2,5–dione, 1-(4-(Phenylamino)phenyl)-1H-pyrrole-2,5-dione, 98%,RG, 98%,RG. Offered by: GLPBio, Chemat. Available pack sizes: 250g, 50g, 1kg, 25g, 100g.
1-(4-anilinophenyl)pyrrole-2,5-dione (CAS 32099-65-3) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 1-(4-anilinophenyl)pyrrole-2,5-dione. InChIKey: KPNYFXUDBVQRNK-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1-(4-anilinophenyl)pyrrole-2,5-dione |
| InChIKey | KPNYFXUDBVQRNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)