CAS 321-24-4 appears in our catalog under these names: 2-Fluoro-4-methoxybenzoyl chloride, 95%, 2-Fluoro-4-methoxybenzoyl chloride 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-fluoro-4-methoxybenzoyl chloride (CAS 321-24-4) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-fluoro-4-methoxybenzoyl chloride. InChIKey: UHLDNUXKNREILG-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-fluoro-4-methoxybenzoyl chloride |
| InChIKey | UHLDNUXKNREILG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)Cl)F |
Computed by PubChem (NCBI)