CAS 321-37-9 appears in our catalog under these names: 4'–Chloro–2,2,2–trifluoroacetophenone, 4'-Chloro-2,2,2-trifluoroacetophenone, >97.0%(GC), 1-(4-Chlorophenyl)-2,2,2-trifluoroethanone 97%, 1-(4-Chlorophenyl)-2,2,2-trifluoroethanone, 97%, 97%, 4'-Chloro-2,2,2-trifluoroacetophenone, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 500g, 250mg, 10g, 50g.
1-(4-chlorophenyl)-2,2,2-trifluoroethanone (CAS 321-37-9) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: DYPQUENOGZXOGE-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | DYPQUENOGZXOGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)