CAS 3215-41-6 appears in our catalog under these names: 9H–carbazole–3,6–dicarboxylic acid, 9H-carbazole-3,6-dicarboxylic acid, 98%, 98%, 9H-carbazole-3,6-dicarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
9H-carbazole-3,6-dicarboxylic acid (CAS 3215-41-6) is a chemical compound with the molecular formula C14H9NO4 and a molecular weight of 255.22 g/mol. IUPAC name: 9H-carbazole-3,6-dicarboxylic acid. InChIKey: KYVPCCXYGLXHDE-UHFFFAOYSA-N.
| Molecular formula | C14H9NO4 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | 9H-carbazole-3,6-dicarboxylic acid |
| InChIKey | KYVPCCXYGLXHDE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C3=C(N2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)