Products 32203-24-0
CAS 32203-24-0 appears in our catalog under these names: Ethyl 2–amino–5–nitrobenzoate, Ethyl 2-amino-5-nitrobenzoate 95%, Ethyl 2-amino-5-nitrobenzoate, 95%, 95%, ETHYL 2-AMINO-5-NITROBENZOATE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
Ethyl 2-amino-5-nitrobenzoate (CAS 32203-24-0) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: ethyl 2-amino-5-nitrobenzoate. InChIKey: AMLDNINFPSEDHZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | ethyl 2-amino-5-nitrobenzoate |
| InChIKey | AMLDNINFPSEDHZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)