Products 3223-79-8
CAS 3223-79-8 is the registry number for 2-(2-Methyl-1H-indol-3-yl)ethan-1-amine oxalate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid (CAS 3223-79-8) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid. InChIKey: OZWLLJOHFQKSLD-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid |
| InChIKey | OZWLLJOHFQKSLD-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2-methyl-1H-indol-3-yl)ethanamine oxalate, 2-Methylindole-3-ethylamine oxalate, 2-(2-methyl-1H-indol-3-yl)ethanamine;oxalic acid, 2-Methyltryptamine oxalate, 2-Methyltryptamine oxalate salt, 2 Methylindole 3 Ethylamine Oxalate, [2-(2-Methyl-1H-indol-3-yl)ethyl]amine oxalate, 2-(2-Methyl-1H-Indol-3-Yl)Ethan-1-Amine Oxalate, Oxalic acid--2-(2-methyl-1H-indol-3-yl)ethan-1-amine (1/1)