CAS 32383-03-2 appears in our catalog under these names: Dimethyl 6-chloropyridine-2,3-dicarboxylate 96%, Dimethyl 6-Chloropyridine-2,3-dicarboxylate, 96%, 96%, 6-Chloropyridine-2,3-dicarboxylic acid dimethyl ester, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Dimethyl 6-chloropyridine-2,3-dicarboxylate (CAS 32383-03-2) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 6-chloropyridine-2,3-dicarboxylate. InChIKey: KEKUTUAIDOVRDG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | dimethyl 6-chloropyridine-2,3-dicarboxylate |
| InChIKey | KEKUTUAIDOVRDG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)