Products 325484-33-1
CAS 325484-33-1 is the registry number for Dehydro Nifedipine-13C,d3. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-(trideuterio(113C)methyl)pyrimidine-2,4-dione (CAS 325484-33-1) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 271.25 g/mol. IUPAC name: 1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-(trideuterio(113C)methyl)pyrimidine-2,4-dione. InChIKey: HBOMLICNUCNMMY-KQORAOOSSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 271.25 g/mol |
| IUPAC name | 1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-(trideuterio(113C)methyl)pyrimidine-2,4-dione |
| InChIKey | HBOMLICNUCNMMY-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])C1=CN(C(=O)NC1=O)C2CC(C(O2)CO)N=[N+]=[N-] |
Computed by PubChem (NCBI)
Synonyms:
Dehydro Nifedipine-13C,d3