CAS 3260-89-7 appears in our catalog under these names: 2–Chloro–6–methoxybenzoic acid, 2-Chloro-6-methoxybenzoic acid 97%, 2-Chloro-6-methoxybenzoic acid, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
2-chloro-6-methoxybenzoic acid (CAS 3260-89-7) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-6-methoxybenzoic acid. InChIKey: JUOHBAJZQDTICO-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-6-methoxybenzoic acid |
| InChIKey | JUOHBAJZQDTICO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)