Products 326850-30-0
CAS 326850-30-0 is the registry number for Nitroparacetamol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-acetamidophenyl) 4-nitrooxybutanoate (CAS 326850-30-0) is a chemical compound with the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. IUPAC name: (4-acetamidophenyl) 4-nitrooxybutanoate. InChIKey: XTMOQAKCOFLCRZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O6 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | (4-acetamidophenyl) 4-nitrooxybutanoate |
| InChIKey | XTMOQAKCOFLCRZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC(=O)CCCO[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Nitroparacetamol, (4-acetamidophenyl) 4-nitrooxybutanoate, Butanoic acid, 4-(nitrooxy)-, 4-(acetylamino)phenyl ester, 4-(acetylamino)phenyl 4-(nitrooxy)butanoate, NO-Paracetamol, 4-(nitroxy)butanoic acid 4-acetylaminophenyl ester, orb1695895, XTMOQAKCOFLCRZ-UHFFFAOYSA-N, 4-(Nitrooxy)butanoic acid 4-acetamidophenyl ester