CAS 344933-31-9 appears in our catalog under these names: (4-tert-Butoxycarbonylamino-cyclohexyl)-acetic acid, 95%, 4-(Boc-amino)cyclohexaneacetic acid, 2-(4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid, 97%, 97%, 2-(4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid, 2-(4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid, 97%. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 10g, 100mg, 250 mg, 100 mg.
2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid (CAS 344933-31-9) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid. InChIKey: IHXBNSUFUFFBRL-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]acetic acid |
| InChIKey | IHXBNSUFUFFBRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)CC(=O)O |
Computed by PubChem (NCBI)