CAS 328-79-0 appears in our catalog under these names: 3-Methoxy-5-nitrobenzotrifluoride, 98%, 3–Methoxy–5–nitrobenzotrifluoride. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g.
1-methoxy-3-nitro-5-(trifluoromethyl)benzene (CAS 328-79-0) is a chemical compound with the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. IUPAC name: 1-methoxy-3-nitro-5-(trifluoromethyl)benzene. InChIKey: NCPVPJVRLLHBEL-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO3 |
|---|---|
| Molecular weight | 221.13 g/mol |
| IUPAC name | 1-methoxy-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | NCPVPJVRLLHBEL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)