Products 328025-30-5

CAS 328025-30-5 is the registry number for 4-Oxo-4-(2-(3-phenylpropanoyl)hydrazinyl)butanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-oxo-4-[2-(3-phenylpropanoyl)hydrazinyl]butanoic acid (CAS 328025-30-5) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: 4-oxo-4-[2-(3-phenylpropanoyl)hydrazinyl]butanoic acid. InChIKey: ALSGYFBQGPQAGW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16N2O4
Molecular weight264.28 g/mol
IUPAC name4-oxo-4-[2-(3-phenylpropanoyl)hydrazinyl]butanoic acid
InChIKeyALSGYFBQGPQAGW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)