CAS 3286-01-9 is the registry number for 2,7-Dimethylanthraquinone, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
2,7-dimethylanthracene-9,10-dione (CAS 3286-01-9) is a chemical compound with the molecular formula C16H12O2 and a molecular weight of 236.26 g/mol. IUPAC name: 2,7-dimethylanthracene-9,10-dione. InChIKey: RATJDSXPVPAWJJ-UHFFFAOYSA-N.
| Molecular formula | C16H12O2 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2,7-dimethylanthracene-9,10-dione |
| InChIKey | RATJDSXPVPAWJJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=O)C3=C(C2=O)C=C(C=C3)C |
Computed by PubChem (NCBI)