CAS 3304-70-9 appears in our catalog under these names: Dimethyl 4,5–imidazoledicarboxylate, Dimethyl 1H-Imidazole-4,5-dicarboxylate, >98.0%(HPLC)(T), Dimethyl 4,5-imidazoledicarboxylate 98%, DIMETHYL 4,5-IMIDAZOLEDICARBOXYLATE, 97%, Dimethyl 4,5-imidazoledicarboxylate, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 10g, 250mg, 1g, 5g, 100g, 500g, 50g.
Dimethyl 1H-imidazole-4,5-dicarboxylate (CAS 3304-70-9) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: dimethyl 1H-imidazole-4,5-dicarboxylate. InChIKey: CUIWFAXEALIQJS-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | dimethyl 1H-imidazole-4,5-dicarboxylate |
| InChIKey | CUIWFAXEALIQJS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=CN1)C(=O)OC |
Computed by PubChem (NCBI)