CAS 3308-02-9 appears in our catalog under these names: 2-Phenylpyridin-3-ol 95%, 2-Phenylpyridin-3-ol, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-phenylpyridin-3-ol (CAS 3308-02-9) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 2-phenylpyridin-3-ol. InChIKey: VHRHRMPFHJXSNR-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 2-phenylpyridin-3-ol |
| InChIKey | VHRHRMPFHJXSNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)O |
Computed by PubChem (NCBI)