CAS 33094-66-5 appears in our catalog under these names: 2-Nitrobenzofuran, 95%, 2–Nitrobenzofuran, 2-Nitrobenzofuran 95%, 2-Nitrobenzofuran, 98%, 98%, 2-Nitrobenzofuran, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-nitro-1-benzofuran (CAS 33094-66-5) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 2-nitro-1-benzofuran. InChIKey: RSZMTXPFGDUHSE-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2-nitro-1-benzofuran |
| InChIKey | RSZMTXPFGDUHSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)