Products 33117-68-9

CAS 33117-68-9 is the registry number for Lidin-M methyl-1, 2, 3, 4, 5, 6-hexahydropyrrolo (3,2,1-I,J) quinolone-2. Offered by: Biosynth. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

11-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (CAS 33117-68-9) is a chemical compound with the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. IUPAC name: 11-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one. InChIKey: NMHATAMEOXJEDB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO
Molecular weight187.24 g/mol
IUPAC name11-methyl-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one
InChIKeyNMHATAMEOXJEDB-UHFFFAOYSA-N
SMILESCC1CCC2=C3N1C(=O)CC3=CC=C2

Computed by PubChem (NCBI)