Products 331239-23-7

CAS 331239-23-7 appears in our catalog under these names: Itopride Impurity 15, Itopride Impurity B, O-Des(2-dimethylaminoethyl)-O-methyl Itopride, >95% (HPLC), 3,4-Dimethoxy-N-((4-methoxyphenyl)methyl)benzamide. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

3,4-dimethoxy-N-[(4-methoxyphenyl)methyl]benzamide (CAS 331239-23-7) is a chemical compound with the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. IUPAC name: 3,4-dimethoxy-N-[(4-methoxyphenyl)methyl]benzamide. InChIKey: VBGRNWZUXVXFFU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO4
Molecular weight301.34 g/mol
IUPAC name3,4-dimethoxy-N-[(4-methoxyphenyl)methyl]benzamide
InChIKeyVBGRNWZUXVXFFU-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C=C2)OC)OC

Computed by PubChem (NCBI)