CAS 331240-54-1 is the registry number for (4-Bromophenyl)-(2,3-dihydroindol-1-yl)methanone. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
(4-bromophenyl)-(2,3-dihydroindol-1-yl)methanone (CAS 331240-54-1) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: (4-bromophenyl)-(2,3-dihydroindol-1-yl)methanone. InChIKey: BDWKIWDJGLWQDE-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | (4-bromophenyl)-(2,3-dihydroindol-1-yl)methanone |
| InChIKey | BDWKIWDJGLWQDE-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)