Products 331662-65-8
CAS 331662-65-8 is the registry number for 5,7-Dimethoxy-4-oxo-1,4-dihydroquinoline-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5,7-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile (CAS 331662-65-8) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 5,7-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: VULJFGGTQMATOG-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 5,7-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | VULJFGGTQMATOG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C(=CN2)C#N |
Computed by PubChem (NCBI)