CAS 332-33-2 is the registry number for 3-(4-Fluorophenyl)-1,1-dimethylurea, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
3-(4-fluorophenyl)-1,1-dimethylurea (CAS 332-33-2) is a chemical compound with the molecular formula C9H11FN2O and a molecular weight of 182.19 g/mol. IUPAC name: 3-(4-fluorophenyl)-1,1-dimethylurea. InChIKey: GNIZUUCYAIPGKZ-UHFFFAOYSA-N.
| Molecular formula | C9H11FN2O |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1,1-dimethylurea |
| InChIKey | GNIZUUCYAIPGKZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)