CAS 3331-28-0 appears in our catalog under these names: 2-Bromophenazine, 95%, 2-Bromophenazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg.
2-bromophenazine (CAS 3331-28-0) is a chemical compound with the molecular formula C12H7BrN2 and a molecular weight of 259.10 g/mol. IUPAC name: 2-bromophenazine. InChIKey: CCFGYBQCAMTETL-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-bromophenazine |
| InChIKey | CCFGYBQCAMTETL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC(=CC3=N2)Br |
Computed by PubChem (NCBI)