CAS 378769-61-0 is the registry number for 2-(5-Bromo-2,3-dihydro-1H-inden-1-ylidene)malononitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-bromo-2,3-dihydroinden-1-ylidene)propanedinitrile (CAS 378769-61-0) is a chemical compound with the molecular formula C12H7BrN2 and a molecular weight of 259.10 g/mol. IUPAC name: 2-(5-bromo-2,3-dihydroinden-1-ylidene)propanedinitrile. InChIKey: QMUUYVSFKASKFX-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-(5-bromo-2,3-dihydroinden-1-ylidene)propanedinitrile |
| InChIKey | QMUUYVSFKASKFX-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C#N)C#N)C2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)